About 2-(3,7-dimethyloct-6-enylamino)-2-methylpropan-1-ol
2-(3,7-dimethyloct-6-enylamino)-2-methylpropan-1-ol (PubChem CID 54502459) has the molecular formula C14H29NO
and a molecular weight of 227.39 g/mol. Its IUPAC name is 2-(3,7-dimethyloct-6-enylamino)-2-methylpropan-1-ol.
Molecular Properties
| Compound Name | 2-(3,7-dimethyloct-6-enylamino)-2-methylpropan-1-ol |
| PubChem CID | 54502459 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 2-(3,7-dimethyloct-6-enylamino)-2-methylpropan-1-ol |
| SMILES | CC(C)=CCCC(C)CCNC(C)(C)CO |
| InChI | InChI=1S/C14H29NO/c1-12(2)7-6-8-13(3)9-10-15-14(4,5)11-16/h7,13,15-16H,6,8-11H2,1-5H3 |
| InChIKey | YDJWOMXCIKIONA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,7-dimethyloct-6-enylamino)-2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,7-dimethyloct-6-enylamino)-2-methylpropan-1-ol?
The IUPAC name of 2-(3,7-dimethyloct-6-enylamino)-2-methylpropan-1-ol (CID 54502459) is 2-(3,7-dimethyloct-6-enylamino)-2-methylpropan-1-ol.
What is the SMILES notation for 2-(3,7-dimethyloct-6-enylamino)-2-methylpropan-1-ol?
The canonical SMILES for 2-(3,7-dimethyloct-6-enylamino)-2-methylpropan-1-ol is CC(C)=CCCC(C)CCNC(C)(C)CO.
What is the InChIKey of 2-(3,7-dimethyloct-6-enylamino)-2-methylpropan-1-ol?
The InChIKey is YDJWOMXCIKIONA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO/c1-12(2)7-6-8-13(3)9-10-15-14(4,5)11-16/h7,13,15-16H,6,8-11H2,1-5H3.
What are the key properties of 2-(3,7-dimethyloct-6-enylamino)-2-methylpropan-1-ol?
2-(3,7-dimethyloct-6-enylamino)-2-methylpropan-1-ol has a molecular weight of 227.39 g/mol, XLogP of 3.12, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,7-dimethyloct-6-enylamino)-2-methylpropan-1-ol is sourced from PubChem (CID 54502459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).