About 1-(aziridin-2-yl)-N,N-dimethylmethanamine
1-(aziridin-2-yl)-N,N-dimethylmethanamine (PubChem CID 54502555) has the molecular formula C5H12N2
and a molecular weight of 100.17 g/mol. Its IUPAC name is 1-(aziridin-2-yl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-(aziridin-2-yl)-N,N-dimethylmethanamine |
| PubChem CID | 54502555 |
| Molecular Formula | C5H12N2 |
| Molecular Weight | 100.17 g/mol |
| Exact Mass | 100.10 |
| IUPAC Name | 1-(aziridin-2-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)CC1CN1 |
| InChI | InChI=1S/C5H12N2/c1-7(2)4-5-3-6-5/h5-6H,3-4H2,1-2H3 |
| InChIKey | YDLQMIDQUADKHM-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 25.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.17 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-(aziridin-2-yl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(aziridin-2-yl)-N,N-dimethylmethanamine?
The IUPAC name of 1-(aziridin-2-yl)-N,N-dimethylmethanamine (CID 54502555) is 1-(aziridin-2-yl)-N,N-dimethylmethanamine.
What is the SMILES notation for 1-(aziridin-2-yl)-N,N-dimethylmethanamine?
The canonical SMILES for 1-(aziridin-2-yl)-N,N-dimethylmethanamine is CN(C)CC1CN1.
What is the InChIKey of 1-(aziridin-2-yl)-N,N-dimethylmethanamine?
The InChIKey is YDLQMIDQUADKHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2/c1-7(2)4-5-3-6-5/h5-6H,3-4H2,1-2H3.
What are the key properties of 1-(aziridin-2-yl)-N,N-dimethylmethanamine?
1-(aziridin-2-yl)-N,N-dimethylmethanamine has a molecular weight of 100.17 g/mol, XLogP of -0.48, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(aziridin-2-yl)-N,N-dimethylmethanamine is sourced from PubChem (CID 54502555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).