About prop-2-enyl (2R,4R)-2-(2-azidoethyl)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate
prop-2-enyl (2R,4R)-2-(2-azidoethyl)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate (PubChem CID 54502598) has the molecular formula C16H30N4O3Si
and a molecular weight of 354.53 g/mol. Its IUPAC name is prop-2-enyl (2R,4R)-2-(2-azidoethyl)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | prop-2-enyl (2R,4R)-2-(2-azidoethyl)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate |
| PubChem CID | 54502598 |
| Molecular Formula | C16H30N4O3Si |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | prop-2-enyl (2R,4R)-2-(2-azidoethyl)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1CCN=[N+]=[N-] |
| InChI | InChI=1S/C16H30N4O3Si/c1-7-10-22-15(21)20-12-14(11-13(20)8-9-18-19-17)23-24(5,6)16(2,3)4/h7,13-14H,1,8-12H2,2-6H3/t13-,14-/m1/s1 |
| InChIKey | YDMJHGIKOXHGNV-ZIAGYGMSSA-N |
| XLogP | 4.47 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl (2R,4R)-2-(2-azidoethyl)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl (2R,4R)-2-(2-azidoethyl)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate?
The IUPAC name of prop-2-enyl (2R,4R)-2-(2-azidoethyl)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate (CID 54502598) is prop-2-enyl (2R,4R)-2-(2-azidoethyl)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate.
What is the SMILES notation for prop-2-enyl (2R,4R)-2-(2-azidoethyl)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate?
The canonical SMILES for prop-2-enyl (2R,4R)-2-(2-azidoethyl)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate is C=CCOC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1CCN=[N+]=[N-].
What is the InChIKey of prop-2-enyl (2R,4R)-2-(2-azidoethyl)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate?
The InChIKey is YDMJHGIKOXHGNV-ZIAGYGMSSA-N. The full InChI is InChI=1S/C16H30N4O3Si/c1-7-10-22-15(21)20-12-14(11-13(20)8-9-18-19-17)23-24(5,6)16(2,3)4/h7,13-14H,1,8-12H2,2-6H3/t13-,14-/m1/s1.
What are the key properties of prop-2-enyl (2R,4R)-2-(2-azidoethyl)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate?
prop-2-enyl (2R,4R)-2-(2-azidoethyl)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate has a molecular weight of 354.53 g/mol, XLogP of 4.47, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl (2R,4R)-2-(2-azidoethyl)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1-carboxylate is sourced from PubChem (CID 54502598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).