About 4-amino-2,3-dinitrobenzenesulfonic acid
4-amino-2,3-dinitrobenzenesulfonic acid (PubChem CID 54502813) has the molecular formula C6H5N3O7S
and a molecular weight of 263.19 g/mol. Its IUPAC name is 4-amino-2,3-dinitrobenzenesulfonic acid.
Molecular Properties
| Compound Name | 4-amino-2,3-dinitrobenzenesulfonic acid |
| PubChem CID | 54502813 |
| Molecular Formula | C6H5N3O7S |
| Molecular Weight | 263.19 g/mol |
| Exact Mass | 262.98 |
| IUPAC Name | 4-amino-2,3-dinitrobenzenesulfonic acid |
| SMILES | Nc1ccc(S(=O)(=O)O)c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H5N3O7S/c7-3-1-2-4(17(14,15)16)6(9(12)13)5(3)8(10)11/h1-2H,7H2,(H,14,15,16) |
| InChIKey | YDQCKMVJCNMCCT-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 166.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.19 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2,3-dinitrobenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,3-dinitrobenzenesulfonic acid?
The IUPAC name of 4-amino-2,3-dinitrobenzenesulfonic acid (CID 54502813) is 4-amino-2,3-dinitrobenzenesulfonic acid.
What is the SMILES notation for 4-amino-2,3-dinitrobenzenesulfonic acid?
The canonical SMILES for 4-amino-2,3-dinitrobenzenesulfonic acid is Nc1ccc(S(=O)(=O)O)c([N+](=O)[O-])c1[N+](=O)[O-].
What is the InChIKey of 4-amino-2,3-dinitrobenzenesulfonic acid?
The InChIKey is YDQCKMVJCNMCCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O7S/c7-3-1-2-4(17(14,15)16)6(9(12)13)5(3)8(10)11/h1-2H,7H2,(H,14,15,16).
What are the key properties of 4-amino-2,3-dinitrobenzenesulfonic acid?
4-amino-2,3-dinitrobenzenesulfonic acid has a molecular weight of 263.19 g/mol, XLogP of 0.33, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,3-dinitrobenzenesulfonic acid is sourced from PubChem (CID 54502813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).