C35H35N7O2 — CID 54503419
3-methyl-N-[1-[methyl-[2-[(3-methylphenazine-1-carbonyl)amino]propyl]amino]propan-2-yl]phenazine-1-carboxamide (PubChem CID 54503419) has the molecular formula C35H35N7O2 and a molecular weight of 585.71 g/mol. Its IUPAC name is 3-methyl-N-[1-[methyl-[2-[(3-methylphenazine-1-carbonyl)amino]propyl]amino]propan-2-yl]phenazine-1-carboxamide.
| Compound Name | 3-methyl-N-[1-[methyl-[2-[(3-methylphenazine-1-carbonyl)amino]propyl]amino]propan-2-yl]phenazine-1-carboxamide |
|---|---|
| PubChem CID | 54503419 |
| Molecular Formula | C35H35N7O2 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.29 |
| IUPAC Name | 3-methyl-N-[1-[methyl-[2-[(3-methylphenazine-1-carbonyl)amino]propyl]amino]propan-2-yl]phenazine-1-carboxamide |
| SMILES | Cc1cc(C(=O)NC(C)CN(C)CC(C)NC(=O)c2cc(C)cc3nc4ccccc4nc23)c2nc3ccccc3nc2c1 |
| InChI | InChI=1S/C35H35N7O2/c1-20-14-24(32-30(16-20)38-26-10-6-8-12-28(26)40-32)34(43)36-22(3)18-42(5)19-23(4)37-35(44)25-15-21(2)17-31-33(25)41-29-13-9-7-11-27(29)39-31/h6-17,22-23H,18-19H2,1-5H3,(H,36,43)(H,37,44) |
| InChIKey | YEANUESLEKDHLJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|