About diethyl-methyl-(6,6,6-trifluorohex-2-enyl)azanium
diethyl-methyl-(6,6,6-trifluorohex-2-enyl)azanium (PubChem CID 54504163) has the molecular formula C11H21F3N+
and a molecular weight of 224.29 g/mol. Its IUPAC name is diethyl-methyl-(6,6,6-trifluorohex-2-enyl)azanium.
Molecular Properties
| Compound Name | diethyl-methyl-(6,6,6-trifluorohex-2-enyl)azanium |
| PubChem CID | 54504163 |
| Molecular Formula | C11H21F3N+ |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | diethyl-methyl-(6,6,6-trifluorohex-2-enyl)azanium |
| SMILES | CC[N+](C)(CC)CC=CCCC(F)(F)F |
| InChI | InChI=1S/C11H21F3N/c1-4-15(3,5-2)10-8-6-7-9-11(12,13)14/h6,8H,4-5,7,9-10H2,1-3H3/q+1 |
| InChIKey | QHOBXMQIDLTPLL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze diethyl-methyl-(6,6,6-trifluorohex-2-enyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl-methyl-(6,6,6-trifluorohex-2-enyl)azanium?
The IUPAC name of diethyl-methyl-(6,6,6-trifluorohex-2-enyl)azanium (CID 54504163) is diethyl-methyl-(6,6,6-trifluorohex-2-enyl)azanium.
What is the SMILES notation for diethyl-methyl-(6,6,6-trifluorohex-2-enyl)azanium?
The canonical SMILES for diethyl-methyl-(6,6,6-trifluorohex-2-enyl)azanium is CC[N+](C)(CC)CC=CCCC(F)(F)F.
What is the InChIKey of diethyl-methyl-(6,6,6-trifluorohex-2-enyl)azanium?
The InChIKey is QHOBXMQIDLTPLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F3N/c1-4-15(3,5-2)10-8-6-7-9-11(12,13)14/h6,8H,4-5,7,9-10H2,1-3H3/q+1.
What are the key properties of diethyl-methyl-(6,6,6-trifluorohex-2-enyl)azanium?
diethyl-methyl-(6,6,6-trifluorohex-2-enyl)azanium has a molecular weight of 224.29 g/mol, XLogP of 3.37, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl-methyl-(6,6,6-trifluorohex-2-enyl)azanium is sourced from PubChem (CID 54504163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).