C26H22N4O3 — CID 54504985
3-[5-(3-aminopropyl)-[1,3]dioxolo[4,5-f]indol-7-yl]-7-phenyl-1H-quinoxalin-2-one (PubChem CID 54504985) has the molecular formula C26H22N4O3 and a molecular weight of 438.49 g/mol. Its IUPAC name is 3-[5-(3-aminopropyl)-[1,3]dioxolo[4,5-f]indol-7-yl]-7-phenyl-1H-quinoxalin-2-one.
| Compound Name | 3-[5-(3-aminopropyl)-[1,3]dioxolo[4,5-f]indol-7-yl]-7-phenyl-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 54504985 |
| Molecular Formula | C26H22N4O3 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 3-[5-(3-aminopropyl)-[1,3]dioxolo[4,5-f]indol-7-yl]-7-phenyl-1H-quinoxalin-2-one |
| SMILES | NCCCn1cc(-c2nc3ccc(-c4ccccc4)cc3[nH]c2=O)c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C26H22N4O3/c27-9-4-10-30-14-19(18-12-23-24(13-22(18)30)33-15-32-23)25-26(31)29-21-11-17(7-8-20(21)28-25)16-5-2-1-3-6-16/h1-3,5-8,11-14H,4,9-10,15,27H2,(H,29,31) |
| InChIKey | YFAVMWMOYPJYDR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |