C18H24N4O4 — CID 5450504
3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]propanamide (PubChem CID 5450504) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]propanamide.
| Compound Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 5450504 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]propanamide |
| SMILES | COc1ccc(/C=N\NC(=O)CCc2c(C)n[nH]c2C)c(OC)c1OC |
| InChI | InChI=1S/C18H24N4O4/c1-11-14(12(2)21-20-11)7-9-16(23)22-19-10-13-6-8-15(24-3)18(26-5)17(13)25-4/h6,8,10H,7,9H2,1-5H3,(H,20,21)(H,22,23)/b19-10- |
| InChIKey | TXAGGAFOOUERNB-GRSHGNNSSA-N |
| XLogP | 2.14 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|