C24H25NO5Si — CID 54505205
(1R,2R)-2-ethyl-5,7-dihydroxy-6,11-dioxo-1-trimethylsilyloxy-3,4-dihydro-2H-tetracene-1-carbonitrile (PubChem CID 54505205) has the molecular formula C24H25NO5Si and a molecular weight of 435.55 g/mol. Its IUPAC name is (1R,2R)-2-ethyl-5,7-dihydroxy-6,11-dioxo-1-trimethylsilyloxy-3,4-dihydro-2H-tetracene-1-carbonitrile.
| Compound Name | (1R,2R)-2-ethyl-5,7-dihydroxy-6,11-dioxo-1-trimethylsilyloxy-3,4-dihydro-2H-tetracene-1-carbonitrile |
|---|---|
| PubChem CID | 54505205 |
| Molecular Formula | C24H25NO5Si |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | (1R,2R)-2-ethyl-5,7-dihydroxy-6,11-dioxo-1-trimethylsilyloxy-3,4-dihydro-2H-tetracene-1-carbonitrile |
| SMILES | CC[C@@H]1CCc2c(cc3c(c2O)C(=O)c2c(O)cccc2C3=O)[C@]1(C#N)O[Si](C)(C)C |
| InChI | InChI=1S/C24H25NO5Si/c1-5-13-9-10-14-17(24(13,12-25)30-31(2,3)4)11-16-20(22(14)28)23(29)19-15(21(16)27)7-6-8-18(19)26/h6-8,11,13,26,28H,5,9-10H2,1-4H3/t13-,24-/m1/s1 |
| InChIKey | YFESICKINDJPJJ-YEBMWUKDSA-N |
| XLogP | 4.42 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|