About 1-oxido-1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-1-ium-2-one
1-oxido-1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-1-ium-2-one (PubChem CID 54505898) has the molecular formula C26H21N3O2
and a molecular weight of 407.47 g/mol. Its IUPAC name is 1-oxido-1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-1-ium-2-one.
Molecular Properties
| Compound Name | 1-oxido-1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-1-ium-2-one |
| PubChem CID | 54505898 |
| Molecular Formula | C26H21N3O2 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 1-oxido-1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-1-ium-2-one |
| SMILES | O=C1C(Cc2ccncc2)(Cc2ccncc2)c2ccccc2[N+]1([O-])c1ccccc1 |
| InChI | InChI=1S/C26H21N3O2/c30-25-26(18-20-10-14-27-15-11-20,19-21-12-16-28-17-13-21)23-8-4-5-9-24(23)29(25,31)22-6-2-1-3-7-22/h1-17H,18-19H2 |
| InChIKey | YFRBBDFTAGLXSZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-oxido-1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-1-ium-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxido-1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-1-ium-2-one?
The IUPAC name of 1-oxido-1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-1-ium-2-one (CID 54505898) is 1-oxido-1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-1-ium-2-one.
What is the SMILES notation for 1-oxido-1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-1-ium-2-one?
The canonical SMILES for 1-oxido-1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-1-ium-2-one is O=C1C(Cc2ccncc2)(Cc2ccncc2)c2ccccc2[N+]1([O-])c1ccccc1.
What is the InChIKey of 1-oxido-1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-1-ium-2-one?
The InChIKey is YFRBBDFTAGLXSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21N3O2/c30-25-26(18-20-10-14-27-15-11-20,19-21-12-16-28-17-13-21)23-8-4-5-9-24(23)29(25,31)22-6-2-1-3-7-22/h1-17H,18-19H2.
What are the key properties of 1-oxido-1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-1-ium-2-one?
1-oxido-1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-1-ium-2-one has a molecular weight of 407.47 g/mol, XLogP of 4.88, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxido-1-phenyl-3,3-bis(pyridin-4-ylmethyl)indol-1-ium-2-one is sourced from PubChem (CID 54505898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).