methyl 4-[[4-(2-phenoxypropyl)piperazin-1-yl]methyl]benzoate

C22H28N2O3 — CID 54506508

IUPACmethyl 4-[[4-(2-phenoxypropyl)piperazin-1-yl]methyl]benzoate
SMILESCOC(=O)c1ccc(CN2CCN(CC(C)Oc3ccccc3)CC2)cc1
InChIInChI=1S/C22H28N2O3/c1-18(27-21-6-4-3-5-7-21)16-23-12-14-24(15-13-23)17-19-8-10-20(11-9-19)22(25)26-2/h3-11,18H,12-17H2,1-2H3
InChIKeyYGBYLIZTHCWWDK-UHFFFAOYSA-N
MW368.48 g/mol
LogP3.06
Rot. Bonds7

About methyl 4-[[4-(2-phenoxypropyl)piperazin-1-yl]methyl]benzoate

methyl 4-[[4-(2-phenoxypropyl)piperazin-1-yl]methyl]benzoate (PubChem CID 54506508) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is methyl 4-[[4-(2-phenoxypropyl)piperazin-1-yl]methyl]benzoate.

Molecular Properties

Compound Namemethyl 4-[[4-(2-phenoxypropyl)piperazin-1-yl]methyl]benzoate
PubChem CID54506508
Molecular FormulaC22H28N2O3
Molecular Weight368.48 g/mol
Exact Mass368.21
IUPAC Namemethyl 4-[[4-(2-phenoxypropyl)piperazin-1-yl]methyl]benzoate
SMILESCOC(=O)c1ccc(CN2CCN(CC(C)Oc3ccccc3)CC2)cc1
InChIInChI=1S/C22H28N2O3/c1-18(27-21-6-4-3-5-7-21)16-23-12-14-24(15-13-23)17-19-8-10-20(11-9-19)22(25)26-2/h3-11,18H,12-17H2,1-2H3
InChIKeyYGBYLIZTHCWWDK-UHFFFAOYSA-N
XLogP3.06
TPSA42.01 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms27
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500368.48
LogP ≤ 53.06
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 4-[[4-(2-phenoxypropyl)piperazin-1-yl]methyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[[4-(2-phenoxypropyl)piperazin-1-yl]methyl]benzoate?
The IUPAC name of methyl 4-[[4-(2-phenoxypropyl)piperazin-1-yl]methyl]benzoate (CID 54506508) is methyl 4-[[4-(2-phenoxypropyl)piperazin-1-yl]methyl]benzoate.
What is the SMILES notation for methyl 4-[[4-(2-phenoxypropyl)piperazin-1-yl]methyl]benzoate?
The canonical SMILES for methyl 4-[[4-(2-phenoxypropyl)piperazin-1-yl]methyl]benzoate is COC(=O)c1ccc(CN2CCN(CC(C)Oc3ccccc3)CC2)cc1.
What is the InChIKey of methyl 4-[[4-(2-phenoxypropyl)piperazin-1-yl]methyl]benzoate?
The InChIKey is YGBYLIZTHCWWDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O3/c1-18(27-21-6-4-3-5-7-21)16-23-12-14-24(15-13-23)17-19-8-10-20(11-9-19)22(25)26-2/h3-11,18H,12-17H2,1-2H3.
What are the key properties of methyl 4-[[4-(2-phenoxypropyl)piperazin-1-yl]methyl]benzoate?
methyl 4-[[4-(2-phenoxypropyl)piperazin-1-yl]methyl]benzoate has a molecular weight of 368.48 g/mol, XLogP of 3.06, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[4-(2-phenoxypropyl)piperazin-1-yl]methyl]benzoate is sourced from PubChem (CID 54506508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).