About 1,9-dihydropyrazolo[1,2-a]diazepine
1,9-dihydropyrazolo[1,2-a]diazepine (PubChem CID 54506915) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 1,9-dihydropyrazolo[1,2-a]diazepine.
Molecular Properties
| Compound Name | 1,9-dihydropyrazolo[1,2-a]diazepine |
| PubChem CID | 54506915 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 1,9-dihydropyrazolo[1,2-a]diazepine |
| SMILES | C1=CCN2CC=CN2C=C1 |
| InChI | InChI=1S/C8H10N2/c1-2-5-9-7-4-8-10(9)6-3-1/h1-5,7H,6,8H2 |
| InChIKey | YGJMWNNIFACQAC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,9-dihydropyrazolo[1,2-a]diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,9-dihydropyrazolo[1,2-a]diazepine?
The IUPAC name of 1,9-dihydropyrazolo[1,2-a]diazepine (CID 54506915) is 1,9-dihydropyrazolo[1,2-a]diazepine.
What is the SMILES notation for 1,9-dihydropyrazolo[1,2-a]diazepine?
The canonical SMILES for 1,9-dihydropyrazolo[1,2-a]diazepine is C1=CCN2CC=CN2C=C1.
What is the InChIKey of 1,9-dihydropyrazolo[1,2-a]diazepine?
The InChIKey is YGJMWNNIFACQAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-2-5-9-7-4-8-10(9)6-3-1/h1-5,7H,6,8H2.
What are the key properties of 1,9-dihydropyrazolo[1,2-a]diazepine?
1,9-dihydropyrazolo[1,2-a]diazepine has a molecular weight of 134.18 g/mol, XLogP of 1.12, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,9-dihydropyrazolo[1,2-a]diazepine is sourced from PubChem (CID 54506915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).