C20H33F3N2O5 — CID 54506927
(4-cyclohexyl-1-ethoxy-1-oxobutan-2-yl) (2S)-2-amino-6-[(2,2,2-trifluoroacetyl)amino]hexanoate (PubChem CID 54506927) has the molecular formula C20H33F3N2O5 and a molecular weight of 438.49 g/mol. Its IUPAC name is (4-cyclohexyl-1-ethoxy-1-oxobutan-2-yl) (2S)-2-amino-6-[(2,2,2-trifluoroacetyl)amino]hexanoate.
| Compound Name | (4-cyclohexyl-1-ethoxy-1-oxobutan-2-yl) (2S)-2-amino-6-[(2,2,2-trifluoroacetyl)amino]hexanoate |
|---|---|
| PubChem CID | 54506927 |
| Molecular Formula | C20H33F3N2O5 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | (4-cyclohexyl-1-ethoxy-1-oxobutan-2-yl) (2S)-2-amino-6-[(2,2,2-trifluoroacetyl)amino]hexanoate |
| SMILES | CCOC(=O)C(CCC1CCCCC1)OC(=O)[C@@H](N)CCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C20H33F3N2O5/c1-2-29-18(27)16(12-11-14-8-4-3-5-9-14)30-17(26)15(24)10-6-7-13-25-19(28)20(21,22)23/h14-16H,2-13,24H2,1H3,(H,25,28)/t15-,16?/m0/s1 |
| InChIKey | YGJRLYDPRUEVNZ-VYRBHSGPSA-N |
| XLogP | 3.00 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|