C17H16N4O — CID 545070
1,5-dimethyl-2-phenyl-4-(pyridin-3-ylmethylideneamino)pyrazol-3-one (PubChem CID 545070) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is 1,5-dimethyl-2-phenyl-4-(pyridin-3-ylmethylideneamino)pyrazol-3-one.
| Compound Name | 1,5-dimethyl-2-phenyl-4-(pyridin-3-ylmethylideneamino)pyrazol-3-one |
|---|---|
| PubChem CID | 545070 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 1,5-dimethyl-2-phenyl-4-(pyridin-3-ylmethylideneamino)pyrazol-3-one |
| SMILES | Cc1c(/N=C/c2cccnc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C17H16N4O/c1-13-16(19-12-14-7-6-10-18-11-14)17(22)21(20(13)2)15-8-4-3-5-9-15/h3-12H,1-2H3/b19-12+ |
| InChIKey | AWVOIPJLUITJBA-XDHOZWIPSA-N |
| XLogP | 2.63 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|