C10H15NO3S2 — CID 54507182
2-methyl-3-(4-oxopentanethioyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 54507182) has the molecular formula C10H15NO3S2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-methyl-3-(4-oxopentanethioyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-methyl-3-(4-oxopentanethioyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 54507182 |
| Molecular Formula | C10H15NO3S2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 2-methyl-3-(4-oxopentanethioyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC(=O)CCC(=S)N1C(C)SCC1C(=O)O |
| InChI | InChI=1S/C10H15NO3S2/c1-6(12)3-4-9(15)11-7(2)16-5-8(11)10(13)14/h7-8H,3-5H2,1-2H3,(H,13,14) |
| InChIKey | YGNOVRUMLFDFQP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|