C21H34O7 — CID 54507531
(1S,2S,3S,4R)-3-(carboxymethyl)-4-hydroxy-2-[8-(oxan-2-yloxy)oct-1-enyl]cyclopentane-1-carboxylic acid (PubChem CID 54507531) has the molecular formula C21H34O7 and a molecular weight of 398.50 g/mol. Its IUPAC name is (1S,2S,3S,4R)-3-(carboxymethyl)-4-hydroxy-2-[8-(oxan-2-yloxy)oct-1-enyl]cyclopentane-1-carboxylic acid.
| Compound Name | (1S,2S,3S,4R)-3-(carboxymethyl)-4-hydroxy-2-[8-(oxan-2-yloxy)oct-1-enyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 54507531 |
| Molecular Formula | C21H34O7 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | (1S,2S,3S,4R)-3-(carboxymethyl)-4-hydroxy-2-[8-(oxan-2-yloxy)oct-1-enyl]cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C[C@H]1[C@H](C=CCCCCCCOC2CCCCO2)[C@@H](C(=O)O)C[C@H]1O |
| InChI | InChI=1S/C21H34O7/c22-18-13-17(21(25)26)15(16(18)14-19(23)24)9-5-3-1-2-4-7-11-27-20-10-6-8-12-28-20/h5,9,15-18,20,22H,1-4,6-8,10-14H2,(H,23,24)(H,25,26)/t15-,16-,17-,18+,20?/m0/s1 |
| InChIKey | YGTXAJNMWDYVCY-YLQJXANPSA-N |
| XLogP | 3.21 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|