C27H42O5 — CID 54507895
methyl 5-[(3aS,4R,5R,6aR)-4-oct-1-enyl-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-oxopentanoate (PubChem CID 54507895) has the molecular formula C27H42O5 and a molecular weight of 446.63 g/mol. Its IUPAC name is methyl 5-[(3aS,4R,5R,6aR)-4-oct-1-enyl-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-oxopentanoate.
| Compound Name | methyl 5-[(3aS,4R,5R,6aR)-4-oct-1-enyl-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-oxopentanoate |
|---|---|
| PubChem CID | 54507895 |
| Molecular Formula | C27H42O5 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | methyl 5-[(3aS,4R,5R,6aR)-4-oct-1-enyl-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-oxopentanoate |
| SMILES | CCCCCCC=C[C@@H]1[C@H]2CC(=CCCC(=O)C(=O)OC)C[C@@H]2C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C27H42O5/c1-3-4-5-6-7-8-13-22-23-18-20(12-11-14-24(28)27(29)30-2)17-21(23)19-25(22)32-26-15-9-10-16-31-26/h8,12-13,21-23,25-26H,3-7,9-11,14-19H2,1-2H3/t21-,22-,23+,25-,26?/m1/s1 |
| InChIKey | YGZYUQXXYGXFKT-ONYGBUPMSA-N |
| XLogP | 5.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|