About 5-diethoxyphosphoryl-2-ethoxy-3,4-dimethyl-1,2λ5-oxaphospholane 2-oxide
5-diethoxyphosphoryl-2-ethoxy-3,4-dimethyl-1,2λ5-oxaphospholane 2-oxide (PubChem CID 54508345) has the molecular formula C11H24O6P2
and a molecular weight of 314.26 g/mol. Its IUPAC name is 5-diethoxyphosphoryl-2-ethoxy-3,4-dimethyl-1,2λ5-oxaphospholane 2-oxide.
Molecular Properties
| Compound Name | 5-diethoxyphosphoryl-2-ethoxy-3,4-dimethyl-1,2λ5-oxaphospholane 2-oxide |
| PubChem CID | 54508345 |
| Molecular Formula | C11H24O6P2 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 5-diethoxyphosphoryl-2-ethoxy-3,4-dimethyl-1,2λ5-oxaphospholane 2-oxide |
| SMILES | CCOP1(=O)OC(P(=O)(OCC)OCC)C(C)C1C |
| InChI | InChI=1S/C11H24O6P2/c1-6-14-18(12)10(5)9(4)11(17-18)19(13,15-7-2)16-8-3/h9-11H,6-8H2,1-5H3 |
| InChIKey | YHIFPOSBXFKNID-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-diethoxyphosphoryl-2-ethoxy-3,4-dimethyl-1,2λ5-oxaphospholane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-diethoxyphosphoryl-2-ethoxy-3,4-dimethyl-1,2λ5-oxaphospholane 2-oxide?
The IUPAC name of 5-diethoxyphosphoryl-2-ethoxy-3,4-dimethyl-1,2λ5-oxaphospholane 2-oxide (CID 54508345) is 5-diethoxyphosphoryl-2-ethoxy-3,4-dimethyl-1,2λ5-oxaphospholane 2-oxide.
What is the SMILES notation for 5-diethoxyphosphoryl-2-ethoxy-3,4-dimethyl-1,2λ5-oxaphospholane 2-oxide?
The canonical SMILES for 5-diethoxyphosphoryl-2-ethoxy-3,4-dimethyl-1,2λ5-oxaphospholane 2-oxide is CCOP1(=O)OC(P(=O)(OCC)OCC)C(C)C1C.
What is the InChIKey of 5-diethoxyphosphoryl-2-ethoxy-3,4-dimethyl-1,2λ5-oxaphospholane 2-oxide?
The InChIKey is YHIFPOSBXFKNID-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O6P2/c1-6-14-18(12)10(5)9(4)11(17-18)19(13,15-7-2)16-8-3/h9-11H,6-8H2,1-5H3.
What are the key properties of 5-diethoxyphosphoryl-2-ethoxy-3,4-dimethyl-1,2λ5-oxaphospholane 2-oxide?
5-diethoxyphosphoryl-2-ethoxy-3,4-dimethyl-1,2λ5-oxaphospholane 2-oxide has a molecular weight of 314.26 g/mol, XLogP of 3.86, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-diethoxyphosphoryl-2-ethoxy-3,4-dimethyl-1,2λ5-oxaphospholane 2-oxide is sourced from PubChem (CID 54508345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).