About 2-(trichloromethylsulfanyl)-4,7-dihydroisoindole-1,3-diol
2-(trichloromethylsulfanyl)-4,7-dihydroisoindole-1,3-diol (PubChem CID 54508359) has the molecular formula C9H8Cl3NO2S
and a molecular weight of 300.59 g/mol. Its IUPAC name is 2-(trichloromethylsulfanyl)-4,7-dihydroisoindole-1,3-diol.
Molecular Properties
| Compound Name | 2-(trichloromethylsulfanyl)-4,7-dihydroisoindole-1,3-diol |
| PubChem CID | 54508359 |
| Molecular Formula | C9H8Cl3NO2S |
| Molecular Weight | 300.59 g/mol |
| Exact Mass | 298.93 |
| IUPAC Name | 2-(trichloromethylsulfanyl)-4,7-dihydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1SC(Cl)(Cl)Cl)CC=CC2 |
| InChI | InChI=1S/C9H8Cl3NO2S/c10-9(11,12)16-13-7(14)5-3-1-2-4-6(5)8(13)15/h1-2,14-15H,3-4H2 |
| InChIKey | YHILKALTPHRGSY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.59 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(trichloromethylsulfanyl)-4,7-dihydroisoindole-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trichloromethylsulfanyl)-4,7-dihydroisoindole-1,3-diol?
The IUPAC name of 2-(trichloromethylsulfanyl)-4,7-dihydroisoindole-1,3-diol (CID 54508359) is 2-(trichloromethylsulfanyl)-4,7-dihydroisoindole-1,3-diol.
What is the SMILES notation for 2-(trichloromethylsulfanyl)-4,7-dihydroisoindole-1,3-diol?
The canonical SMILES for 2-(trichloromethylsulfanyl)-4,7-dihydroisoindole-1,3-diol is Oc1c2c(c(O)n1SC(Cl)(Cl)Cl)CC=CC2.
What is the InChIKey of 2-(trichloromethylsulfanyl)-4,7-dihydroisoindole-1,3-diol?
The InChIKey is YHILKALTPHRGSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8Cl3NO2S/c10-9(11,12)16-13-7(14)5-3-1-2-4-6(5)8(13)15/h1-2,14-15H,3-4H2.
What are the key properties of 2-(trichloromethylsulfanyl)-4,7-dihydroisoindole-1,3-diol?
2-(trichloromethylsulfanyl)-4,7-dihydroisoindole-1,3-diol has a molecular weight of 300.59 g/mol, XLogP of 3.38, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trichloromethylsulfanyl)-4,7-dihydroisoindole-1,3-diol is sourced from PubChem (CID 54508359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).