C31H56O12 — CID 54508838
[(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-yl]methyl 2-methyloctadec-9-enoate (PubChem CID 54508838) has the molecular formula C31H56O12 and a molecular weight of 620.78 g/mol. Its IUPAC name is [(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-yl]methyl 2-methyloctadec-9-enoate.
| Compound Name | [(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-yl]methyl 2-methyloctadec-9-enoate |
|---|---|
| PubChem CID | 54508838 |
| Molecular Formula | C31H56O12 |
| Molecular Weight | 620.78 g/mol |
| Exact Mass | 620.38 |
| IUPAC Name | [(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-yl]methyl 2-methyloctadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCC(C)C(=O)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C31H56O12/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(2)29(39)40-20-31(28(38)25(35)23(19-33)42-31)43-30-27(37)26(36)24(34)22(18-32)41-30/h10-11,21-28,30,32-38H,3-9,12-20H2,1-2H3/t21?,22-,23-,24-,25-,26+,27-,28+,30-,31+/m1/s1 |
| InChIKey | YHQSMNOATRHLOK-VKHAIAFBSA-N |
| XLogP | 1.44 |
| TPSA | 195.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.78 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|