C26H46O8 — CID 54508991
[(4aS,6R,7R,7aS)-4a-methoxy-2,2-dimethyl-7-octanoyloxy-4,6,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-yl]methyl octanoate (PubChem CID 54508991) has the molecular formula C26H46O8 and a molecular weight of 486.65 g/mol. Its IUPAC name is [(4aS,6R,7R,7aS)-4a-methoxy-2,2-dimethyl-7-octanoyloxy-4,6,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-yl]methyl octanoate.
| Compound Name | [(4aS,6R,7R,7aS)-4a-methoxy-2,2-dimethyl-7-octanoyloxy-4,6,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-yl]methyl octanoate |
|---|---|
| PubChem CID | 54508991 |
| Molecular Formula | C26H46O8 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | [(4aS,6R,7R,7aS)-4a-methoxy-2,2-dimethyl-7-octanoyloxy-4,6,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-yl]methyl octanoate |
| SMILES | CCCCCCCC(=O)OC[C@H]1O[C@@]2(OC)COC(C)(C)O[C@H]2[C@@H]1OC(=O)CCCCCCC |
| InChI | InChI=1S/C26H46O8/c1-6-8-10-12-14-16-21(27)30-18-20-23(32-22(28)17-15-13-11-9-7-2)24-26(29-5,33-20)19-31-25(3,4)34-24/h20,23-24H,6-19H2,1-5H3/t20-,23-,24+,26+/m1/s1 |
| InChIKey | YHTMRYJGAADTNA-ALYVEICOSA-N |
| XLogP | 5.06 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|