About 2,3-dihydroxy-N',N'-dipropylbutanediamide
2,3-dihydroxy-N',N'-dipropylbutanediamide (PubChem CID 54509098) has the molecular formula C10H20N2O4
and a molecular weight of 232.28 g/mol. Its IUPAC name is 2,3-dihydroxy-N',N'-dipropylbutanediamide.
Molecular Properties
| Compound Name | 2,3-dihydroxy-N',N'-dipropylbutanediamide |
| PubChem CID | 54509098 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 2,3-dihydroxy-N',N'-dipropylbutanediamide |
| SMILES | CCCN(CCC)C(=O)C(O)C(O)C(N)=O |
| InChI | InChI=1S/C10H20N2O4/c1-3-5-12(6-4-2)10(16)8(14)7(13)9(11)15/h7-8,13-14H,3-6H2,1-2H3,(H2,11,15) |
| InChIKey | YHVKGEXOMBVJFM-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dihydroxy-N',N'-dipropylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxy-N',N'-dipropylbutanediamide?
The IUPAC name of 2,3-dihydroxy-N',N'-dipropylbutanediamide (CID 54509098) is 2,3-dihydroxy-N',N'-dipropylbutanediamide.
What is the SMILES notation for 2,3-dihydroxy-N',N'-dipropylbutanediamide?
The canonical SMILES for 2,3-dihydroxy-N',N'-dipropylbutanediamide is CCCN(CCC)C(=O)C(O)C(O)C(N)=O.
What is the InChIKey of 2,3-dihydroxy-N',N'-dipropylbutanediamide?
The InChIKey is YHVKGEXOMBVJFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O4/c1-3-5-12(6-4-2)10(16)8(14)7(13)9(11)15/h7-8,13-14H,3-6H2,1-2H3,(H2,11,15).
What are the key properties of 2,3-dihydroxy-N',N'-dipropylbutanediamide?
2,3-dihydroxy-N',N'-dipropylbutanediamide has a molecular weight of 232.28 g/mol, XLogP of -1.16, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxy-N',N'-dipropylbutanediamide is sourced from PubChem (CID 54509098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).