About 2-[[5-(3,5-dichlorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazol-2-yl]methoxy]acetaldehyde
2-[[5-(3,5-dichlorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazol-2-yl]methoxy]acetaldehyde (PubChem CID 54509160) has the molecular formula C16H18Cl2N2O2S
and a molecular weight of 373.31 g/mol. Its IUPAC name is 2-[[5-(3,5-dichlorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazol-2-yl]methoxy]acetaldehyde.
Molecular Properties
| Compound Name | 2-[[5-(3,5-dichlorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazol-2-yl]methoxy]acetaldehyde |
| PubChem CID | 54509160 |
| Molecular Formula | C16H18Cl2N2O2S |
| Molecular Weight | 373.31 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 2-[[5-(3,5-dichlorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazol-2-yl]methoxy]acetaldehyde |
| SMILES | CC(C)c1nc(COCC=O)n(C)c1Sc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H18Cl2N2O2S/c1-10(2)15-16(20(3)14(19-15)9-22-5-4-21)23-13-7-11(17)6-12(18)8-13/h4,6-8,10H,5,9H2,1-3H3 |
| InChIKey | YHWOAXAJPLAXGZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.31 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[[5-(3,5-dichlorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazol-2-yl]methoxy]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(3,5-dichlorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazol-2-yl]methoxy]acetaldehyde?
The IUPAC name of 2-[[5-(3,5-dichlorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazol-2-yl]methoxy]acetaldehyde (CID 54509160) is 2-[[5-(3,5-dichlorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazol-2-yl]methoxy]acetaldehyde.
What is the SMILES notation for 2-[[5-(3,5-dichlorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazol-2-yl]methoxy]acetaldehyde?
The canonical SMILES for 2-[[5-(3,5-dichlorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazol-2-yl]methoxy]acetaldehyde is CC(C)c1nc(COCC=O)n(C)c1Sc1cc(Cl)cc(Cl)c1.
What is the InChIKey of 2-[[5-(3,5-dichlorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazol-2-yl]methoxy]acetaldehyde?
The InChIKey is YHWOAXAJPLAXGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18Cl2N2O2S/c1-10(2)15-16(20(3)14(19-15)9-22-5-4-21)23-13-7-11(17)6-12(18)8-13/h4,6-8,10H,5,9H2,1-3H3.
What are the key properties of 2-[[5-(3,5-dichlorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazol-2-yl]methoxy]acetaldehyde?
2-[[5-(3,5-dichlorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazol-2-yl]methoxy]acetaldehyde has a molecular weight of 373.31 g/mol, XLogP of 4.72, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(3,5-dichlorophenyl)sulfanyl-1-methyl-4-propan-2-ylimidazol-2-yl]methoxy]acetaldehyde is sourced from PubChem (CID 54509160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).