C16H24N4 — CID 54509393
4-methyl-3-(2-methylpropyl)-3,5,8-triazatricyclo[7.5.0.02,6]tetradeca-1(9),2(6),4,7-tetraen-7-amine (PubChem CID 54509393) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is 4-methyl-3-(2-methylpropyl)-3,5,8-triazatricyclo[7.5.0.02,6]tetradeca-1(9),2(6),4,7-tetraen-7-amine.
| Compound Name | 4-methyl-3-(2-methylpropyl)-3,5,8-triazatricyclo[7.5.0.02,6]tetradeca-1(9),2(6),4,7-tetraen-7-amine |
|---|---|
| PubChem CID | 54509393 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 4-methyl-3-(2-methylpropyl)-3,5,8-triazatricyclo[7.5.0.02,6]tetradeca-1(9),2(6),4,7-tetraen-7-amine |
| SMILES | Cc1nc2c(N)nc3c(c2n1CC(C)C)CCCCC3 |
| InChI | InChI=1S/C16H24N4/c1-10(2)9-20-11(3)18-14-15(20)12-7-5-4-6-8-13(12)19-16(14)17/h10H,4-9H2,1-3H3,(H2,17,19) |
| InChIKey | YIARDSFXDJBKRW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |