About 7-(6-amino-3,5-dimethyl-2-pyridinyl)-1-(2-methoxypyrimidin-5-yl)hept-1-en-3-one
7-(6-amino-3,5-dimethyl-2-pyridinyl)-1-(2-methoxypyrimidin-5-yl)hept-1-en-3-one (PubChem CID 54509541) has the molecular formula C19H24N4O2
and a molecular weight of 340.43 g/mol. Its IUPAC name is 7-(6-amino-3,5-dimethyl-2-pyridinyl)-1-(2-methoxypyrimidin-5-yl)hept-1-en-3-one.
Molecular Properties
| Compound Name | 7-(6-amino-3,5-dimethyl-2-pyridinyl)-1-(2-methoxypyrimidin-5-yl)hept-1-en-3-one |
| PubChem CID | 54509541 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 7-(6-amino-3,5-dimethyl-2-pyridinyl)-1-(2-methoxypyrimidin-5-yl)hept-1-en-3-one |
| SMILES | COc1ncc(C=CC(=O)CCCCc2nc(N)c(C)cc2C)cn1 |
| InChI | InChI=1S/C19H24N4O2/c1-13-10-14(2)18(20)23-17(13)7-5-4-6-16(24)9-8-15-11-21-19(25-3)22-12-15/h8-12H,4-7H2,1-3H3,(H2,20,23) |
| InChIKey | YIDGEBDCPSSBTN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 7-(6-amino-3,5-dimethyl-2-pyridinyl)-1-(2-methoxypyrimidin-5-yl)hept-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(6-amino-3,5-dimethyl-2-pyridinyl)-1-(2-methoxypyrimidin-5-yl)hept-1-en-3-one?
The IUPAC name of 7-(6-amino-3,5-dimethyl-2-pyridinyl)-1-(2-methoxypyrimidin-5-yl)hept-1-en-3-one (CID 54509541) is 7-(6-amino-3,5-dimethyl-2-pyridinyl)-1-(2-methoxypyrimidin-5-yl)hept-1-en-3-one.
What is the SMILES notation for 7-(6-amino-3,5-dimethyl-2-pyridinyl)-1-(2-methoxypyrimidin-5-yl)hept-1-en-3-one?
The canonical SMILES for 7-(6-amino-3,5-dimethyl-2-pyridinyl)-1-(2-methoxypyrimidin-5-yl)hept-1-en-3-one is COc1ncc(C=CC(=O)CCCCc2nc(N)c(C)cc2C)cn1.
What is the InChIKey of 7-(6-amino-3,5-dimethyl-2-pyridinyl)-1-(2-methoxypyrimidin-5-yl)hept-1-en-3-one?
The InChIKey is YIDGEBDCPSSBTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N4O2/c1-13-10-14(2)18(20)23-17(13)7-5-4-6-16(24)9-8-15-11-21-19(25-3)22-12-15/h8-12H,4-7H2,1-3H3,(H2,20,23).
What are the key properties of 7-(6-amino-3,5-dimethyl-2-pyridinyl)-1-(2-methoxypyrimidin-5-yl)hept-1-en-3-one?
7-(6-amino-3,5-dimethyl-2-pyridinyl)-1-(2-methoxypyrimidin-5-yl)hept-1-en-3-one has a molecular weight of 340.43 g/mol, XLogP of 3.07, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(6-amino-3,5-dimethyl-2-pyridinyl)-1-(2-methoxypyrimidin-5-yl)hept-1-en-3-one is sourced from PubChem (CID 54509541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).