C60H84O6 — CID 54509913
[3-[6-[2-(3,5-ditert-butyl-4-hydroxyphenyl)phenyl]hexanoyloxy]-2,2,4,4-tetramethylcyclobutyl] 6-[2-(3,5-ditert-butyl-4-hydroxyphenyl)phenyl]hexanoate (PubChem CID 54509913) has the molecular formula C60H84O6 and a molecular weight of 901.33 g/mol. Its IUPAC name is [3-[6-[2-(3,5-ditert-butyl-4-hydroxyphenyl)phenyl]hexanoyloxy]-2,2,4,4-tetramethylcyclobutyl] 6-[2-(3,5-ditert-butyl-4-hydroxyphenyl)phenyl]hexanoate.
| Compound Name | [3-[6-[2-(3,5-ditert-butyl-4-hydroxyphenyl)phenyl]hexanoyloxy]-2,2,4,4-tetramethylcyclobutyl] 6-[2-(3,5-ditert-butyl-4-hydroxyphenyl)phenyl]hexanoate |
|---|---|
| PubChem CID | 54509913 |
| Molecular Formula | C60H84O6 |
| Molecular Weight | 901.33 g/mol |
| Exact Mass | 900.63 |
| IUPAC Name | [3-[6-[2-(3,5-ditert-butyl-4-hydroxyphenyl)phenyl]hexanoyloxy]-2,2,4,4-tetramethylcyclobutyl] 6-[2-(3,5-ditert-butyl-4-hydroxyphenyl)phenyl]hexanoate |
| SMILES | CC(C)(C)c1cc(-c2ccccc2CCCCCC(=O)OC2C(C)(C)C(OC(=O)CCCCCc3ccccc3-c3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)C2(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C60H84O6/c1-55(2,3)45-35-41(36-46(51(45)63)56(4,5)6)43-31-25-23-29-39(43)27-19-17-21-33-49(61)65-53-59(13,14)54(60(53,15)16)66-50(62)34-22-18-20-28-40-30-24-26-32-44(40)42-37-47(57(7,8)9)52(64)48(38-42)58(10,11)12/h23-26,29-32,35-38,53-54,63-64H,17-22,27-28,33-34H2,1-16H3 |
| InChIKey | YIJPPMDJUZFLPR-UHFFFAOYSA-N |
| XLogP | 15.42 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.33 |
| LogP ≤ 5 | 15.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|