C18H27N — CID 54510107
6-pentyl-1,2,3,4,4a,5,6,6a-octahydrophenanthridine (PubChem CID 54510107) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is 6-pentyl-1,2,3,4,4a,5,6,6a-octahydrophenanthridine.
| Compound Name | 6-pentyl-1,2,3,4,4a,5,6,6a-octahydrophenanthridine |
|---|---|
| PubChem CID | 54510107 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 6-pentyl-1,2,3,4,4a,5,6,6a-octahydrophenanthridine |
| SMILES | CCCCCC1NC2CCCCC2=C2C=CC=CC21 |
| InChI | InChI=1S/C18H27N/c1-2-3-4-12-17-15-10-6-5-9-14(15)16-11-7-8-13-18(16)19-17/h5-6,9-10,15,17-19H,2-4,7-8,11-13H2,1H3 |
| InChIKey | YIMWBGDGILQIAS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|