About (5S)-3,4-dimethoxy-1-methyl-5-propa-1,2-dienylpyrrolidin-2-one
(5S)-3,4-dimethoxy-1-methyl-5-propa-1,2-dienylpyrrolidin-2-one (PubChem CID 54510274) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is (5S)-3,4-dimethoxy-1-methyl-5-propa-1,2-dienylpyrrolidin-2-one.
Molecular Properties
| Compound Name | (5S)-3,4-dimethoxy-1-methyl-5-propa-1,2-dienylpyrrolidin-2-one |
| PubChem CID | 54510274 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | (5S)-3,4-dimethoxy-1-methyl-5-propa-1,2-dienylpyrrolidin-2-one |
| SMILES | C=C=C[C@H]1C(OC)C(OC)C(=O)N1C |
| InChI | InChI=1S/C10H15NO3/c1-5-6-7-8(13-3)9(14-4)10(12)11(7)2/h6-9H,1H2,2-4H3/t7-,8?,9?/m0/s1 |
| InChIKey | YIPKRSZDMHYOJU-UEJVZZJDSA-N |
| XLogP | 0.20 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S)-3,4-dimethoxy-1-methyl-5-propa-1,2-dienylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-3,4-dimethoxy-1-methyl-5-propa-1,2-dienylpyrrolidin-2-one?
The IUPAC name of (5S)-3,4-dimethoxy-1-methyl-5-propa-1,2-dienylpyrrolidin-2-one (CID 54510274) is (5S)-3,4-dimethoxy-1-methyl-5-propa-1,2-dienylpyrrolidin-2-one.
What is the SMILES notation for (5S)-3,4-dimethoxy-1-methyl-5-propa-1,2-dienylpyrrolidin-2-one?
The canonical SMILES for (5S)-3,4-dimethoxy-1-methyl-5-propa-1,2-dienylpyrrolidin-2-one is C=C=C[C@H]1C(OC)C(OC)C(=O)N1C.
What is the InChIKey of (5S)-3,4-dimethoxy-1-methyl-5-propa-1,2-dienylpyrrolidin-2-one?
The InChIKey is YIPKRSZDMHYOJU-UEJVZZJDSA-N. The full InChI is InChI=1S/C10H15NO3/c1-5-6-7-8(13-3)9(14-4)10(12)11(7)2/h6-9H,1H2,2-4H3/t7-,8?,9?/m0/s1.
What are the key properties of (5S)-3,4-dimethoxy-1-methyl-5-propa-1,2-dienylpyrrolidin-2-one?
(5S)-3,4-dimethoxy-1-methyl-5-propa-1,2-dienylpyrrolidin-2-one has a molecular weight of 197.23 g/mol, XLogP of 0.20, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-3,4-dimethoxy-1-methyl-5-propa-1,2-dienylpyrrolidin-2-one is sourced from PubChem (CID 54510274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).