About S-pentyl propanethioate
S-pentyl propanethioate (PubChem CID 545108) has the molecular formula C8H16OS
and a molecular weight of 160.28 g/mol. Its IUPAC name is S-pentyl propanethioate.
Molecular Properties
| Compound Name | S-pentyl propanethioate |
| PubChem CID | 545108 |
| Molecular Formula | C8H16OS |
| Molecular Weight | 160.28 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | S-pentyl propanethioate |
| SMILES | CCCCCSC(=O)CC |
| InChI | InChI=1S/C8H16OS/c1-3-5-6-7-10-8(9)4-2/h3-7H2,1-2H3 |
| InChIKey | QWQQABHFUJEFNJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-pentyl propanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-pentyl propanethioate?
The IUPAC name of S-pentyl propanethioate (CID 545108) is S-pentyl propanethioate.
What is the SMILES notation for S-pentyl propanethioate?
The canonical SMILES for S-pentyl propanethioate is CCCCCSC(=O)CC.
What is the InChIKey of S-pentyl propanethioate?
The InChIKey is QWQQABHFUJEFNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16OS/c1-3-5-6-7-10-8(9)4-2/h3-7H2,1-2H3.
What are the key properties of S-pentyl propanethioate?
S-pentyl propanethioate has a molecular weight of 160.28 g/mol, XLogP of 2.85, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-pentyl propanethioate is sourced from PubChem (CID 545108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).