C17H26F2O3 — CID 54510802
2-[4-(6,6-difluoro-5-methyl-2,3-dihydropyran-2-yl)cyclohexyl]-5-methyl-1,3-dioxane (PubChem CID 54510802) has the molecular formula C17H26F2O3 and a molecular weight of 316.39 g/mol. Its IUPAC name is 2-[4-(6,6-difluoro-5-methyl-2,3-dihydropyran-2-yl)cyclohexyl]-5-methyl-1,3-dioxane.
| Compound Name | 2-[4-(6,6-difluoro-5-methyl-2,3-dihydropyran-2-yl)cyclohexyl]-5-methyl-1,3-dioxane |
|---|---|
| PubChem CID | 54510802 |
| Molecular Formula | C17H26F2O3 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 2-[4-(6,6-difluoro-5-methyl-2,3-dihydropyran-2-yl)cyclohexyl]-5-methyl-1,3-dioxane |
| SMILES | CC1=CCC(C2CCC(C3OCC(C)CO3)CC2)OC1(F)F |
| InChI | InChI=1S/C17H26F2O3/c1-11-9-20-16(21-10-11)14-6-4-13(5-7-14)15-8-3-12(2)17(18,19)22-15/h3,11,13-16H,4-10H2,1-2H3 |
| InChIKey | YIZBTLKUCZNLTG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|