C14F12 — CID 54510849
1,2,3,4,5-pentafluoro-6-[2,3,5,6-tetrafluoro-4-(1,2,2-trifluoroethenyl)phenyl]benzene (PubChem CID 54510849) has the molecular formula C14F12 and a molecular weight of 396.13 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[2,3,5,6-tetrafluoro-4-(1,2,2-trifluoroethenyl)phenyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[2,3,5,6-tetrafluoro-4-(1,2,2-trifluoroethenyl)phenyl]benzene |
|---|---|
| PubChem CID | 54510849 |
| Molecular Formula | C14F12 |
| Molecular Weight | 396.13 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[2,3,5,6-tetrafluoro-4-(1,2,2-trifluoroethenyl)phenyl]benzene |
| SMILES | FC(F)=C(F)c1c(F)c(F)c(-c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C14F12/c15-4-1(2-6(17)11(22)13(24)12(23)7(2)18)5(16)9(20)3(8(4)19)10(21)14(25)26 |
| InChIKey | YIZXEHWYXLDIID-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.13 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|