C25H32N4O3 — CID 54511221
3-phenyl-3-[[4-(4-piperidin-4-ylpiperazin-1-yl)benzoyl]amino]propanoic acid (PubChem CID 54511221) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is 3-phenyl-3-[[4-(4-piperidin-4-ylpiperazin-1-yl)benzoyl]amino]propanoic acid.
| Compound Name | 3-phenyl-3-[[4-(4-piperidin-4-ylpiperazin-1-yl)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 54511221 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 3-phenyl-3-[[4-(4-piperidin-4-ylpiperazin-1-yl)benzoyl]amino]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)c1ccc(N2CCN(C3CCNCC3)CC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H32N4O3/c30-24(31)18-23(19-4-2-1-3-5-19)27-25(32)20-6-8-21(9-7-20)28-14-16-29(17-15-28)22-10-12-26-13-11-22/h1-9,22-23,26H,10-18H2,(H,27,32)(H,30,31) |
| InChIKey | YJGKAEWNPPCWIU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |