C33H48O2 — CID 54511298
(4S)-4,5-dimethyl-2-[(1E,3E,5E,7E,9E,11E,13E)-3,8,12-trimethyl-14-(2,3,4,6,6-pentamethylcyclohexen-1-yl)tetradeca-1,3,5,7,9,11,13-heptaenyl]-1,3-dioxolane (PubChem CID 54511298) has the molecular formula C33H48O2 and a molecular weight of 476.75 g/mol. Its IUPAC name is (4S)-4,5-dimethyl-2-[(1E,3E,5E,7E,9E,11E,13E)-3,8,12-trimethyl-14-(2,3,4,6,6-pentamethylcyclohexen-1-yl)tetradeca-1,3,5,7,9,11,13-heptaenyl]-1,3-dioxolane.
| Compound Name | (4S)-4,5-dimethyl-2-[(1E,3E,5E,7E,9E,11E,13E)-3,8,12-trimethyl-14-(2,3,4,6,6-pentamethylcyclohexen-1-yl)tetradeca-1,3,5,7,9,11,13-heptaenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 54511298 |
| Molecular Formula | C33H48O2 |
| Molecular Weight | 476.75 g/mol |
| Exact Mass | 476.37 |
| IUPAC Name | (4S)-4,5-dimethyl-2-[(1E,3E,5E,7E,9E,11E,13E)-3,8,12-trimethyl-14-(2,3,4,6,6-pentamethylcyclohexen-1-yl)tetradeca-1,3,5,7,9,11,13-heptaenyl]-1,3-dioxolane |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C=C/C=C(C)/C=C/C2OC(C)[C@H](C)O2)C(C)(C)CC(C)C1C |
| InChI | InChI=1S/C33H48O2/c1-23(14-11-12-15-24(2)19-21-32-34-29(7)30(8)35-32)16-13-17-25(3)18-20-31-28(6)27(5)26(4)22-33(31,9)10/h11-21,26-27,29-30,32H,22H2,1-10H3/b12-11+,16-13+,20-18+,21-19+,23-14+,24-15+,25-17+/t26?,27?,29-,30?,32?/m0/s1 |
| InChIKey | YJHNOSJPYLSWRU-USXSWFLGSA-N |
| XLogP | 9.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.75 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|