About 4-butyl-4-(furan-2-yl)-1,2,4-triazol-4-ium
4-butyl-4-(furan-2-yl)-1,2,4-triazol-4-ium (PubChem CID 54511381) has the molecular formula C10H14N3O+
and a molecular weight of 192.24 g/mol. Its IUPAC name is 4-butyl-4-(furan-2-yl)-1,2,4-triazol-4-ium.
Molecular Properties
| Compound Name | 4-butyl-4-(furan-2-yl)-1,2,4-triazol-4-ium |
| PubChem CID | 54511381 |
| Molecular Formula | C10H14N3O+ |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 4-butyl-4-(furan-2-yl)-1,2,4-triazol-4-ium |
| SMILES | CCCC[N+]1(c2ccco2)C=NN=C1 |
| InChI | InChI=1S/C10H14N3O/c1-2-3-6-13(8-11-12-9-13)10-5-4-7-14-10/h4-5,7-9H,2-3,6H2,1H3/q+1 |
| InChIKey | YPTCHEJWHJEJFF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 37.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-butyl-4-(furan-2-yl)-1,2,4-triazol-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-4-(furan-2-yl)-1,2,4-triazol-4-ium?
The IUPAC name of 4-butyl-4-(furan-2-yl)-1,2,4-triazol-4-ium (CID 54511381) is 4-butyl-4-(furan-2-yl)-1,2,4-triazol-4-ium.
What is the SMILES notation for 4-butyl-4-(furan-2-yl)-1,2,4-triazol-4-ium?
The canonical SMILES for 4-butyl-4-(furan-2-yl)-1,2,4-triazol-4-ium is CCCC[N+]1(c2ccco2)C=NN=C1.
What is the InChIKey of 4-butyl-4-(furan-2-yl)-1,2,4-triazol-4-ium?
The InChIKey is YPTCHEJWHJEJFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N3O/c1-2-3-6-13(8-11-12-9-13)10-5-4-7-14-10/h4-5,7-9H,2-3,6H2,1H3/q+1.
What are the key properties of 4-butyl-4-(furan-2-yl)-1,2,4-triazol-4-ium?
4-butyl-4-(furan-2-yl)-1,2,4-triazol-4-ium has a molecular weight of 192.24 g/mol, XLogP of 2.37, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-4-(furan-2-yl)-1,2,4-triazol-4-ium is sourced from PubChem (CID 54511381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).