C17H26O2 — CID 54511470
4-(3-cyclohexyl-3-hydroxyprop-1-enyl)-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one (PubChem CID 54511470) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 4-(3-cyclohexyl-3-hydroxyprop-1-enyl)-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one.
| Compound Name | 4-(3-cyclohexyl-3-hydroxyprop-1-enyl)-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one |
|---|---|
| PubChem CID | 54511470 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 4-(3-cyclohexyl-3-hydroxyprop-1-enyl)-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one |
| SMILES | O=C1CCC2C(C=CC(O)C3CCCCC3)CCC12 |
| InChI | InChI=1S/C17H26O2/c18-16(13-4-2-1-3-5-13)10-7-12-6-8-15-14(12)9-11-17(15)19/h7,10,12-16,18H,1-6,8-9,11H2 |
| InChIKey | YJKWLBQFRJUZOR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|