About 5-ethyl-2,4-dimethyl-6,8-dioxabicyclo[3.2.1]octane
5-ethyl-2,4-dimethyl-6,8-dioxabicyclo[3.2.1]octane (PubChem CID 545115) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is 5-ethyl-2,4-dimethyl-6,8-dioxabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | 5-ethyl-2,4-dimethyl-6,8-dioxabicyclo[3.2.1]octane |
| PubChem CID | 545115 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 5-ethyl-2,4-dimethyl-6,8-dioxabicyclo[3.2.1]octane |
| SMILES | CCC12OCC(O1)C(C)CC2C |
| InChI | InChI=1S/C10H18O2/c1-4-10-8(3)5-7(2)9(12-10)6-11-10/h7-9H,4-6H2,1-3H3 |
| InChIKey | YMBRJMLOGNZRFY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-2,4-dimethyl-6,8-dioxabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2,4-dimethyl-6,8-dioxabicyclo[3.2.1]octane?
The IUPAC name of 5-ethyl-2,4-dimethyl-6,8-dioxabicyclo[3.2.1]octane (CID 545115) is 5-ethyl-2,4-dimethyl-6,8-dioxabicyclo[3.2.1]octane.
What is the SMILES notation for 5-ethyl-2,4-dimethyl-6,8-dioxabicyclo[3.2.1]octane?
The canonical SMILES for 5-ethyl-2,4-dimethyl-6,8-dioxabicyclo[3.2.1]octane is CCC12OCC(O1)C(C)CC2C.
What is the InChIKey of 5-ethyl-2,4-dimethyl-6,8-dioxabicyclo[3.2.1]octane?
The InChIKey is YMBRJMLOGNZRFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-4-10-8(3)5-7(2)9(12-10)6-11-10/h7-9H,4-6H2,1-3H3.
What are the key properties of 5-ethyl-2,4-dimethyl-6,8-dioxabicyclo[3.2.1]octane?
5-ethyl-2,4-dimethyl-6,8-dioxabicyclo[3.2.1]octane has a molecular weight of 170.25 g/mol, XLogP of 2.18, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2,4-dimethyl-6,8-dioxabicyclo[3.2.1]octane is sourced from PubChem (CID 545115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).