About 6-[2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-1H-pyrimidin-2-one
6-[2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-1H-pyrimidin-2-one (PubChem CID 54511648) has the molecular formula C8H10N2O3S
and a molecular weight of 214.25 g/mol. Its IUPAC name is 6-[2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-1H-pyrimidin-2-one.
Molecular Properties
| Compound Name | 6-[2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-1H-pyrimidin-2-one |
| PubChem CID | 54511648 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 6-[2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-1H-pyrimidin-2-one |
| SMILES | O=c1nccc(C2CSC(CO)O2)[nH]1 |
| InChI | InChI=1S/C8H10N2O3S/c11-3-7-13-6(4-14-7)5-1-2-9-8(12)10-5/h1-2,6-7,11H,3-4H2,(H,9,10,12) |
| InChIKey | YJODPNCRFVUIQW-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-1H-pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-1H-pyrimidin-2-one?
The IUPAC name of 6-[2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-1H-pyrimidin-2-one (CID 54511648) is 6-[2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-1H-pyrimidin-2-one.
What is the SMILES notation for 6-[2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-1H-pyrimidin-2-one?
The canonical SMILES for 6-[2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-1H-pyrimidin-2-one is O=c1nccc(C2CSC(CO)O2)[nH]1.
What is the InChIKey of 6-[2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-1H-pyrimidin-2-one?
The InChIKey is YJODPNCRFVUIQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3S/c11-3-7-13-6(4-14-7)5-1-2-9-8(12)10-5/h1-2,6-7,11H,3-4H2,(H,9,10,12).
What are the key properties of 6-[2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-1H-pyrimidin-2-one?
6-[2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-1H-pyrimidin-2-one has a molecular weight of 214.25 g/mol, XLogP of -0.11, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-1H-pyrimidin-2-one is sourced from PubChem (CID 54511648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).