C27H33F2NO3 — CID 54512027
(4aS,8aS)-6-(4-fluorophenyl)-2-[3-[2-(4-fluorophenyl)-1,3-dioxolan-2-yl]propyl]-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-6-ol (PubChem CID 54512027) has the molecular formula C27H33F2NO3 and a molecular weight of 457.56 g/mol. Its IUPAC name is (4aS,8aS)-6-(4-fluorophenyl)-2-[3-[2-(4-fluorophenyl)-1,3-dioxolan-2-yl]propyl]-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-6-ol.
| Compound Name | (4aS,8aS)-6-(4-fluorophenyl)-2-[3-[2-(4-fluorophenyl)-1,3-dioxolan-2-yl]propyl]-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-6-ol |
|---|---|
| PubChem CID | 54512027 |
| Molecular Formula | C27H33F2NO3 |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | (4aS,8aS)-6-(4-fluorophenyl)-2-[3-[2-(4-fluorophenyl)-1,3-dioxolan-2-yl]propyl]-1,3,4,4a,5,7,8,8a-octahydroisoquinolin-6-ol |
| SMILES | OC1(c2ccc(F)cc2)CC[C@@H]2CN(CCCC3(c4ccc(F)cc4)OCCO3)CC[C@H]2C1 |
| InChI | InChI=1S/C27H33F2NO3/c28-24-6-2-22(3-7-24)26(31)13-10-21-19-30(15-11-20(21)18-26)14-1-12-27(32-16-17-33-27)23-4-8-25(29)9-5-23/h2-9,20-21,31H,1,10-19H2/t20-,21+,26?/m0/s1 |
| InChIKey | YJUPFHMPYDINAR-IEDSLXKASA-N |
| XLogP | 4.95 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |