About 4-methyl-1,2,4-triazole-3-carboxylic acid
4-methyl-1,2,4-triazole-3-carboxylic acid (PubChem CID 54512152) has the molecular formula C4H5N3O2
and a molecular weight of 127.10 g/mol. Its IUPAC name is 4-methyl-1,2,4-triazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-methyl-1,2,4-triazole-3-carboxylic acid |
| PubChem CID | 54512152 |
| Molecular Formula | C4H5N3O2 |
| Molecular Weight | 127.10 g/mol |
| Exact Mass | 127.04 |
| IUPAC Name | 4-methyl-1,2,4-triazole-3-carboxylic acid |
| SMILES | Cn1cnnc1C(=O)O |
| InChI | InChI=1S/C4H5N3O2/c1-7-2-5-6-3(7)4(8)9/h2H,1H3,(H,8,9) |
| InChIKey | VWDMYHWYTOQKHH-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.10 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-1,2,4-triazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,2,4-triazole-3-carboxylic acid?
The IUPAC name of 4-methyl-1,2,4-triazole-3-carboxylic acid (CID 54512152) is 4-methyl-1,2,4-triazole-3-carboxylic acid.
What is the SMILES notation for 4-methyl-1,2,4-triazole-3-carboxylic acid?
The canonical SMILES for 4-methyl-1,2,4-triazole-3-carboxylic acid is Cn1cnnc1C(=O)O.
What is the InChIKey of 4-methyl-1,2,4-triazole-3-carboxylic acid?
The InChIKey is VWDMYHWYTOQKHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3O2/c1-7-2-5-6-3(7)4(8)9/h2H,1H3,(H,8,9).
What are the key properties of 4-methyl-1,2,4-triazole-3-carboxylic acid?
4-methyl-1,2,4-triazole-3-carboxylic acid has a molecular weight of 127.10 g/mol, XLogP of -0.49, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,2,4-triazole-3-carboxylic acid is sourced from PubChem (CID 54512152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).