About 1-(4,4,4-trifluorobutylsulfonyl)piperazine
1-(4,4,4-trifluorobutylsulfonyl)piperazine (PubChem CID 54512311) has the molecular formula C8H15F3N2O2S
and a molecular weight of 260.28 g/mol. Its IUPAC name is 1-(4,4,4-trifluorobutylsulfonyl)piperazine.
Molecular Properties
| Compound Name | 1-(4,4,4-trifluorobutylsulfonyl)piperazine |
| PubChem CID | 54512311 |
| Molecular Formula | C8H15F3N2O2S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1-(4,4,4-trifluorobutylsulfonyl)piperazine |
| SMILES | O=S(=O)(CCCC(F)(F)F)N1CCNCC1 |
| InChI | InChI=1S/C8H15F3N2O2S/c9-8(10,11)2-1-7-16(14,15)13-5-3-12-4-6-13/h12H,1-7H2 |
| InChIKey | HVXTZTMSCNKPBX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4,4,4-trifluorobutylsulfonyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4,4-trifluorobutylsulfonyl)piperazine?
The IUPAC name of 1-(4,4,4-trifluorobutylsulfonyl)piperazine (CID 54512311) is 1-(4,4,4-trifluorobutylsulfonyl)piperazine.
What is the SMILES notation for 1-(4,4,4-trifluorobutylsulfonyl)piperazine?
The canonical SMILES for 1-(4,4,4-trifluorobutylsulfonyl)piperazine is O=S(=O)(CCCC(F)(F)F)N1CCNCC1.
What is the InChIKey of 1-(4,4,4-trifluorobutylsulfonyl)piperazine?
The InChIKey is HVXTZTMSCNKPBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F3N2O2S/c9-8(10,11)2-1-7-16(14,15)13-5-3-12-4-6-13/h12H,1-7H2.
What are the key properties of 1-(4,4,4-trifluorobutylsulfonyl)piperazine?
1-(4,4,4-trifluorobutylsulfonyl)piperazine has a molecular weight of 260.28 g/mol, XLogP of 0.56, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4,4-trifluorobutylsulfonyl)piperazine is sourced from PubChem (CID 54512311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).