C14H28O5 — CID 54512713
5-methoxy-6-(methoxymethyl)-2,2,3,4,5,6-hexamethyloxane-3,4-diol (PubChem CID 54512713) has the molecular formula C14H28O5 and a molecular weight of 276.37 g/mol. Its IUPAC name is 5-methoxy-6-(methoxymethyl)-2,2,3,4,5,6-hexamethyloxane-3,4-diol.
| Compound Name | 5-methoxy-6-(methoxymethyl)-2,2,3,4,5,6-hexamethyloxane-3,4-diol |
|---|---|
| PubChem CID | 54512713 |
| Molecular Formula | C14H28O5 |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 5-methoxy-6-(methoxymethyl)-2,2,3,4,5,6-hexamethyloxane-3,4-diol |
| SMILES | COCC1(C)OC(C)(C)C(C)(O)C(C)(O)C1(C)OC |
| InChI | InChI=1S/C14H28O5/c1-10(2)12(4,15)13(5,16)14(6,18-8)11(3,19-10)9-17-7/h15-16H,9H2,1-8H3 |
| InChIKey | YKGQBDJPBDVFMJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |