C22H19F5N2O4 — CID 54513030
N-[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-2,2,3,3,3-pentafluoro-N-phenylmethoxypropanamide (PubChem CID 54513030) has the molecular formula C22H19F5N2O4 and a molecular weight of 470.39 g/mol. Its IUPAC name is N-[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-2,2,3,3,3-pentafluoro-N-phenylmethoxypropanamide.
| Compound Name | N-[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-2,2,3,3,3-pentafluoro-N-phenylmethoxypropanamide |
|---|---|
| PubChem CID | 54513030 |
| Molecular Formula | C22H19F5N2O4 |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | N-[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]-2,2,3,3,3-pentafluoro-N-phenylmethoxypropanamide |
| SMILES | CC1(C)Oc2ccc(C#N)cc2[C@H](N(OCc2ccccc2)C(=O)C(F)(F)C(F)(F)F)[C@H]1O |
| InChI | InChI=1S/C22H19F5N2O4/c1-20(2)18(30)17(15-10-14(11-28)8-9-16(15)33-20)29(19(31)21(23,24)22(25,26)27)32-12-13-6-4-3-5-7-13/h3-10,17-18,30H,12H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | YKMBMXBYXJZRHK-ZWKOTPCHSA-N |
| XLogP | 4.29 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|