C16H15N3O — CID 54513115
2-(3,4-dimethylphenyl)-5-pyridin-3-yl-1H-pyrazol-3-one (PubChem CID 54513115) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-5-pyridin-3-yl-1H-pyrazol-3-one.
| Compound Name | 2-(3,4-dimethylphenyl)-5-pyridin-3-yl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 54513115 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-5-pyridin-3-yl-1H-pyrazol-3-one |
| SMILES | Cc1ccc(-n2[nH]c(-c3cccnc3)cc2=O)cc1C |
| InChI | InChI=1S/C16H15N3O/c1-11-5-6-14(8-12(11)2)19-16(20)9-15(18-19)13-4-3-7-17-10-13/h3-10,18H,1-2H3 |
| InChIKey | YKNOZRPSNWWJNK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |