C18H21NO2 — CID 54513146
(3R,7aS)-6-cyclohex-2-en-1-yl-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 54513146) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (3R,7aS)-6-cyclohex-2-en-1-yl-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (3R,7aS)-6-cyclohex-2-en-1-yl-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 54513146 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (3R,7aS)-6-cyclohex-2-en-1-yl-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | O=C1C(C2C=CCCC2)C[C@H]2CO[C@H](c3ccccc3)N12 |
| InChI | InChI=1S/C18H21NO2/c20-17-16(13-7-3-1-4-8-13)11-15-12-21-18(19(15)17)14-9-5-2-6-10-14/h2-3,5-7,9-10,13,15-16,18H,1,4,8,11-12H2/t13?,15-,16?,18+/m0/s1 |
| InChIKey | YKOCZBVPBAFXMG-CXBLAEQGSA-N |
| XLogP | 3.29 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|