C9H12O2 — CID 54513352
3,5-dimethyl-4-oxocyclohex-2-ene-1-carbaldehyde (PubChem CID 54513352) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 3,5-dimethyl-4-oxocyclohex-2-ene-1-carbaldehyde.
| Compound Name | 3,5-dimethyl-4-oxocyclohex-2-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 54513352 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 3,5-dimethyl-4-oxocyclohex-2-ene-1-carbaldehyde |
| SMILES | CC1=CC(C=O)CC(C)C1=O |
| InChI | InChI=1S/C9H12O2/c1-6-3-8(5-10)4-7(2)9(6)11/h3,5,7-8H,4H2,1-2H3 |
| InChIKey | YKRRIUGMYFLQPP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|