C13H14N2O3 — CID 54513636
N-[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]formamide (PubChem CID 54513636) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is N-[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]formamide.
| Compound Name | N-[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]formamide |
|---|---|
| PubChem CID | 54513636 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-[(3R,4S)-6-cyano-3-hydroxy-2,2-dimethyl-3,4-dihydrochromen-4-yl]formamide |
| SMILES | CC1(C)Oc2ccc(C#N)cc2[C@H](NC=O)[C@H]1O |
| InChI | InChI=1S/C13H14N2O3/c1-13(2)12(17)11(15-7-16)9-5-8(6-14)3-4-10(9)18-13/h3-5,7,11-12,17H,1-2H3,(H,15,16)/t11-,12+/m0/s1 |
| InChIKey | YKWHCEANORWQRW-NWDGAFQWSA-N |
| XLogP | 0.88 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|