About 1-(methylideneamino)-N,N-bis[(methylideneamino)methyl]methanamine
1-(methylideneamino)-N,N-bis[(methylideneamino)methyl]methanamine (PubChem CID 54513700) has the molecular formula C6H12N4
and a molecular weight of 140.19 g/mol. Its IUPAC name is 1-(methylideneamino)-N,N-bis[(methylideneamino)methyl]methanamine.
Molecular Properties
| Compound Name | 1-(methylideneamino)-N,N-bis[(methylideneamino)methyl]methanamine |
| PubChem CID | 54513700 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | 1-(methylideneamino)-N,N-bis[(methylideneamino)methyl]methanamine |
| SMILES | C=NCN(CN=C)CN=C |
| InChI | InChI=1S/C6H12N4/c1-7-4-10(5-8-2)6-9-3/h1-6H2 |
| InChIKey | YKXMAYGVUWYJPZ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(methylideneamino)-N,N-bis[(methylideneamino)methyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(methylideneamino)-N,N-bis[(methylideneamino)methyl]methanamine?
The IUPAC name of 1-(methylideneamino)-N,N-bis[(methylideneamino)methyl]methanamine (CID 54513700) is 1-(methylideneamino)-N,N-bis[(methylideneamino)methyl]methanamine.
What is the SMILES notation for 1-(methylideneamino)-N,N-bis[(methylideneamino)methyl]methanamine?
The canonical SMILES for 1-(methylideneamino)-N,N-bis[(methylideneamino)methyl]methanamine is C=NCN(CN=C)CN=C.
What is the InChIKey of 1-(methylideneamino)-N,N-bis[(methylideneamino)methyl]methanamine?
The InChIKey is YKXMAYGVUWYJPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4/c1-7-4-10(5-8-2)6-9-3/h1-6H2.
What are the key properties of 1-(methylideneamino)-N,N-bis[(methylideneamino)methyl]methanamine?
1-(methylideneamino)-N,N-bis[(methylideneamino)methyl]methanamine has a molecular weight of 140.19 g/mol, XLogP of 0.26, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methylideneamino)-N,N-bis[(methylideneamino)methyl]methanamine is sourced from PubChem (CID 54513700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).