C21H25FN4O3 — CID 54513743
methyl 3-[6-fluoro-2-[[3-(pyrimidin-2-ylamino)propylamino]methyl]-3,4-dihydro-2H-chromen-8-yl]prop-2-enoate (PubChem CID 54513743) has the molecular formula C21H25FN4O3 and a molecular weight of 400.45 g/mol. Its IUPAC name is methyl 3-[6-fluoro-2-[[3-(pyrimidin-2-ylamino)propylamino]methyl]-3,4-dihydro-2H-chromen-8-yl]prop-2-enoate.
| Compound Name | methyl 3-[6-fluoro-2-[[3-(pyrimidin-2-ylamino)propylamino]methyl]-3,4-dihydro-2H-chromen-8-yl]prop-2-enoate |
|---|---|
| PubChem CID | 54513743 |
| Molecular Formula | C21H25FN4O3 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | methyl 3-[6-fluoro-2-[[3-(pyrimidin-2-ylamino)propylamino]methyl]-3,4-dihydro-2H-chromen-8-yl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1cc(F)cc2c1OC(CNCCCNc1ncccn1)CC2 |
| InChI | InChI=1S/C21H25FN4O3/c1-28-19(27)7-5-16-13-17(22)12-15-4-6-18(29-20(15)16)14-23-8-2-9-24-21-25-10-3-11-26-21/h3,5,7,10-13,18,23H,2,4,6,8-9,14H2,1H3,(H,24,25,26) |
| InChIKey | YKYGJPQQOPMDCE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|