About 2-imino-4-methylhexanoic acid
2-imino-4-methylhexanoic acid (PubChem CID 54514537) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is 2-imino-4-methylhexanoic acid.
Molecular Properties
| Compound Name | 2-imino-4-methylhexanoic acid |
| PubChem CID | 54514537 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 2-imino-4-methylhexanoic acid |
| SMILES | [H]/N=C(/CC(C)CC)C(=O)O |
| InChI | InChI=1S/C7H13NO2/c1-3-5(2)4-6(8)7(9)10/h5,8H,3-4H2,1-2H3,(H,9,10)/b8-6- |
| InChIKey | YLMCXRNJETXKJQ-VURMDHGXSA-N |
| XLogP | 1.53 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-imino-4-methylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imino-4-methylhexanoic acid?
The IUPAC name of 2-imino-4-methylhexanoic acid (CID 54514537) is 2-imino-4-methylhexanoic acid.
What is the SMILES notation for 2-imino-4-methylhexanoic acid?
The canonical SMILES for 2-imino-4-methylhexanoic acid is [H]/N=C(/CC(C)CC)C(=O)O.
What is the InChIKey of 2-imino-4-methylhexanoic acid?
The InChIKey is YLMCXRNJETXKJQ-VURMDHGXSA-N. The full InChI is InChI=1S/C7H13NO2/c1-3-5(2)4-6(8)7(9)10/h5,8H,3-4H2,1-2H3,(H,9,10)/b8-6-.
What are the key properties of 2-imino-4-methylhexanoic acid?
2-imino-4-methylhexanoic acid has a molecular weight of 143.19 g/mol, XLogP of 1.53, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imino-4-methylhexanoic acid is sourced from PubChem (CID 54514537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).