C18H23NO2S2 — CID 54514606
5-[(3,5-ditert-butyl-2-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 54514606) has the molecular formula C18H23NO2S2 and a molecular weight of 349.52 g/mol. Its IUPAC name is 5-[(3,5-ditert-butyl-2-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[(3,5-ditert-butyl-2-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 54514606 |
| Molecular Formula | C18H23NO2S2 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 5-[(3,5-ditert-butyl-2-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC(C)(C)c1cc(C=C2SC(=S)NC2=O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H23NO2S2/c1-17(2,3)11-7-10(8-13-15(21)19-16(22)23-13)14(20)12(9-11)18(4,5)6/h7-9,20H,1-6H3,(H,19,21,22) |
| InChIKey | YLNMAVPJJMVHPE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|